C18H30O3 — CID 71004713
(3-hydroxy-5-methyl-1-adamantyl)methyl 2,2-dimethylbutanoate (PubChem CID 71004713) has the molecular formula C18H30O3 and a molecular weight of 294.43 g/mol. Its IUPAC name is (3-hydroxy-5-methyl-1-adamantyl)methyl 2,2-dimethylbutanoate.
| Compound Name | (3-hydroxy-5-methyl-1-adamantyl)methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 71004713 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (3-hydroxy-5-methyl-1-adamantyl)methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC12CC3CC(C)(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C18H30O3/c1-5-15(2,3)14(19)21-12-17-7-13-6-16(4,9-17)10-18(20,8-13)11-17/h13,20H,5-12H2,1-4H3 |
| InChIKey | OHRDJZJSOXKZAV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |