C11H18O2 — CID 55250245
(1R,3S)-5-methyladamantane-1,3-diol (PubChem CID 55250245) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (1R,3S)-5-methyladamantane-1,3-diol.
| Compound Name | (1R,3S)-5-methyladamantane-1,3-diol |
|---|---|
| PubChem CID | 55250245 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (1R,3S)-5-methyladamantane-1,3-diol |
| SMILES | CC12CC3C[C@@](O)(C1)C[C@](O)(C3)C2 |
| InChI | InChI=1S/C11H18O2/c1-9-2-8-3-10(12,5-9)7-11(13,4-8)6-9/h8,12-13H,2-7H2,1H3/t8?,9?,10-,11+ |
| InChIKey | OJZXOFBHKPTMPZ-HWACXVBKSA-N |
| XLogP | 1.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |