C14H25NO2 — CID 22463517
5-(diethylamino)adamantane-1,3-diol (PubChem CID 22463517) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 5-(diethylamino)adamantane-1,3-diol.
| Compound Name | 5-(diethylamino)adamantane-1,3-diol |
|---|---|
| PubChem CID | 22463517 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 5-(diethylamino)adamantane-1,3-diol |
| SMILES | CCN(CC)C12CC3CC(O)(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C14H25NO2/c1-3-15(4-2)12-5-11-6-13(16,8-12)10-14(17,7-11)9-12/h11,16-17H,3-10H2,1-2H3 |
| InChIKey | XDLOVYIMNWAHRP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |