C13H22O — CID 1225075
(5S,7R)-3-propyladamantan-1-ol (PubChem CID 1225075) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (5S,7R)-3-propyladamantan-1-ol.
| Compound Name | (5S,7R)-3-propyladamantan-1-ol |
|---|---|
| PubChem CID | 1225075 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (5S,7R)-3-propyladamantan-1-ol |
| SMILES | CCCC12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C13H22O/c1-2-3-12-5-10-4-11(6-12)8-13(14,7-10)9-12/h10-11,14H,2-9H2,1H3/t10-,11+,12?,13? |
| InChIKey | DASJOTIHKLXABK-MPEURRAXSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |