3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid

C13H20O3 — CID 6928724

IUPAC3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid
SMILESO=C(O)CCC12C[C@H]3C[C@@H](CC(O)(C3)C1)C2
InChIInChI=1S/C13H20O3/c14-11(15)1-2-12-4-9-3-10(5-12)7-13(16,6-9)8-12/h9-10,16H,1-8H2,(H,14,15)/t9-,10-,12?,13?/m1/s1
InChIKeyCKPYPBHTUFDNQS-ITSCGTHASA-N
MW224.30 g/mol
LogP2.18
Rot. Bonds3

About 3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid

3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid (PubChem CID 6928724) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid.

Molecular Properties

Compound Name3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid
PubChem CID6928724
Molecular FormulaC13H20O3
Molecular Weight224.30 g/mol
Exact Mass224.14
IUPAC Name3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid
SMILESO=C(O)CCC12C[C@H]3C[C@@H](CC(O)(C3)C1)C2
InChIInChI=1S/C13H20O3/c14-11(15)1-2-12-4-9-3-10(5-12)7-13(16,6-9)8-12/h9-10,16H,1-8H2,(H,14,15)/t9-,10-,12?,13?/m1/s1
InChIKeyCKPYPBHTUFDNQS-ITSCGTHASA-N
XLogP2.18
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.30
LogP ≤ 52.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid?
The IUPAC name of 3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid (CID 6928724) is 3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid.
What is the SMILES notation for 3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid?
The canonical SMILES for 3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid is O=C(O)CCC12C[C@H]3C[C@@H](CC(O)(C3)C1)C2.
What is the InChIKey of 3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid?
The InChIKey is CKPYPBHTUFDNQS-ITSCGTHASA-N. The full InChI is InChI=1S/C13H20O3/c14-11(15)1-2-12-4-9-3-10(5-12)7-13(16,6-9)8-12/h9-10,16H,1-8H2,(H,14,15)/t9-,10-,12?,13?/m1/s1.
What are the key properties of 3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid?
3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid has a molecular weight of 224.30 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5R,7R)-3-hydroxy-1-adamantyl]propanoic acid is sourced from PubChem (CID 6928724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).