C19H24FNO2 — CID 158486688
N-(2-fluorophenyl)-3-(3-hydroxy-1-adamantyl)propanamide (PubChem CID 158486688) has the molecular formula C19H24FNO2 and a molecular weight of 317.40 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-(3-hydroxy-1-adamantyl)propanamide.
| Compound Name | N-(2-fluorophenyl)-3-(3-hydroxy-1-adamantyl)propanamide |
|---|---|
| PubChem CID | 158486688 |
| Molecular Formula | C19H24FNO2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | N-(2-fluorophenyl)-3-(3-hydroxy-1-adamantyl)propanamide |
| SMILES | O=C(CCC12CC3CC(CC(O)(C3)C1)C2)Nc1ccccc1F |
| InChI | InChI=1S/C19H24FNO2/c20-15-3-1-2-4-16(15)21-17(22)5-6-18-8-13-7-14(9-18)11-19(23,10-13)12-18/h1-4,13-14,23H,5-12H2,(H,21,22) |
| InChIKey | CZLMVJFQPBJEAL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |