C13H18BrO2- — CID 3354667
3-(3-bromo-1-adamantyl)propanoate (PubChem CID 3354667) has the molecular formula C13H18BrO2- and a molecular weight of 286.19 g/mol. Its IUPAC name is 3-(3-bromo-1-adamantyl)propanoate.
| Compound Name | 3-(3-bromo-1-adamantyl)propanoate |
|---|---|
| PubChem CID | 3354667 |
| Molecular Formula | C13H18BrO2- |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 3-(3-bromo-1-adamantyl)propanoate |
| SMILES | O=C([O-])CCC12CC3CC(CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C13H19BrO2/c14-13-6-9-3-10(7-13)5-12(4-9,8-13)2-1-11(15)16/h9-10H,1-8H2,(H,15,16)/p-1 |
| InChIKey | FRKSRQAWMIEBEW-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|