C16H24BrNO2 — CID 98285029
2-[(5R,7R)-3-bromo-1-adamantyl]-1-[3-(hydroxymethyl)azetidin-1-yl]ethanone (PubChem CID 98285029) has the molecular formula C16H24BrNO2 and a molecular weight of 342.28 g/mol. Its IUPAC name is 2-[(5R,7R)-3-bromo-1-adamantyl]-1-[3-(hydroxymethyl)azetidin-1-yl]ethanone.
| Compound Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-1-[3-(hydroxymethyl)azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 98285029 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-1-[3-(hydroxymethyl)azetidin-1-yl]ethanone |
| SMILES | O=C(CC12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2)N1CC(CO)C1 |
| InChI | InChI=1S/C16H24BrNO2/c17-16-4-11-1-12(5-16)3-15(2-11,10-16)6-14(20)18-7-13(8-18)9-19/h11-13,19H,1-10H2/t11-,12-,15?,16?/m1/s1 |
| InChIKey | HXWQEEGWNPDJSM-CPWXYTRJSA-N |
| XLogP | 2.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|