C20H32BrNO — CID 5074995
2-(3-bromo-1-adamantyl)-N-(2,3-dimethylcyclohexyl)acetamide (PubChem CID 5074995) has the molecular formula C20H32BrNO and a molecular weight of 382.39 g/mol. Its IUPAC name is 2-(3-bromo-1-adamantyl)-N-(2,3-dimethylcyclohexyl)acetamide.
| Compound Name | 2-(3-bromo-1-adamantyl)-N-(2,3-dimethylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 5074995 |
| Molecular Formula | C20H32BrNO |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-(3-bromo-1-adamantyl)-N-(2,3-dimethylcyclohexyl)acetamide |
| SMILES | CC1CCCC(NC(=O)CC23CC4CC(CC(Br)(C4)C2)C3)C1C |
| InChI | InChI=1S/C20H32BrNO/c1-13-4-3-5-17(14(13)2)22-18(23)11-19-7-15-6-16(8-19)10-20(21,9-15)12-19/h13-17H,3-12H2,1-2H3,(H,22,23) |
| InChIKey | QRLXYXPSDDQCER-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|