C13H21Br2NO — CID 27520020
(1R)-2,2-dibromo-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 27520020) has the molecular formula C13H21Br2NO and a molecular weight of 367.13 g/mol. Its IUPAC name is (1R)-2,2-dibromo-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dibromo-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 27520020 |
| Molecular Formula | C13H21Br2NO |
| Molecular Weight | 367.13 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | (1R)-2,2-dibromo-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)[C@@]1(C)CC1(Br)Br |
| InChI | InChI=1S/C13H21Br2NO/c1-8-5-4-6-10(9(8)2)16-11(17)12(3)7-13(12,14)15/h8-10H,4-7H2,1-3H3,(H,16,17)/t8-,9-,10+,12-/m1/s1 |
| InChIKey | ONPFGMBLRBYCSL-MWGHHZFTSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.13 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|