C12H24N2O — CID 79025321
(2S)-2-amino-N-(2,3-dimethylcyclohexyl)butanamide (PubChem CID 79025321) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,3-dimethylcyclohexyl)butanamide.
| Compound Name | (2S)-2-amino-N-(2,3-dimethylcyclohexyl)butanamide |
|---|---|
| PubChem CID | 79025321 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | (2S)-2-amino-N-(2,3-dimethylcyclohexyl)butanamide |
| SMILES | CC[C@H](N)C(=O)NC1CCCC(C)C1C |
| InChI | InChI=1S/C12H24N2O/c1-4-10(13)12(15)14-11-7-5-6-8(2)9(11)3/h8-11H,4-7,13H2,1-3H3,(H,14,15)/t8?,9?,10-,11?/m0/s1 |
| InChIKey | RIPWXWRCJOZAND-MWJCJQSMSA-N |
| XLogP | 1.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |