C12H24N2O2 — CID 81082305
2-amino-N-(2,3-dimethylcyclohexyl)-3-methoxypropanamide (PubChem CID 81082305) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-amino-N-(2,3-dimethylcyclohexyl)-3-methoxypropanamide.
| Compound Name | 2-amino-N-(2,3-dimethylcyclohexyl)-3-methoxypropanamide |
|---|---|
| PubChem CID | 81082305 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 2-amino-N-(2,3-dimethylcyclohexyl)-3-methoxypropanamide |
| SMILES | COCC(N)C(=O)NC1CCCC(C)C1C |
| InChI | InChI=1S/C12H24N2O2/c1-8-5-4-6-11(9(8)2)14-12(15)10(13)7-16-3/h8-11H,4-7,13H2,1-3H3,(H,14,15) |
| InChIKey | CPCWYFQKGSFCHN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |