C24H32BrN3O2 — CID 60571906
1-[1-[2-(3-bromo-1-adamantyl)acetyl]piperidin-4-yl]-3-phenylurea (PubChem CID 60571906) has the molecular formula C24H32BrN3O2 and a molecular weight of 474.44 g/mol. Its IUPAC name is 1-[1-[2-(3-bromo-1-adamantyl)acetyl]piperidin-4-yl]-3-phenylurea.
| Compound Name | 1-[1-[2-(3-bromo-1-adamantyl)acetyl]piperidin-4-yl]-3-phenylurea |
|---|---|
| PubChem CID | 60571906 |
| Molecular Formula | C24H32BrN3O2 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 1-[1-[2-(3-bromo-1-adamantyl)acetyl]piperidin-4-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)NC1CCN(C(=O)CC23CC4CC(CC(Br)(C4)C2)C3)CC1 |
| InChI | InChI=1S/C24H32BrN3O2/c25-24-13-17-10-18(14-24)12-23(11-17,16-24)15-21(29)28-8-6-20(7-9-28)27-22(30)26-19-4-2-1-3-5-19/h1-5,17-18,20H,6-16H2,(H2,26,27,30) |
| InChIKey | WOVDCXCPVJPJAD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|