C17H26BrNO — CID 18313532
2-[(5R,7R)-3-bromo-1-adamantyl]-N-cyclopentylacetamide (PubChem CID 18313532) has the molecular formula C17H26BrNO and a molecular weight of 340.31 g/mol. Its IUPAC name is 2-[(5R,7R)-3-bromo-1-adamantyl]-N-cyclopentylacetamide.
| Compound Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 18313532 |
| Molecular Formula | C17H26BrNO |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-N-cyclopentylacetamide |
| SMILES | O=C(CC12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2)NC1CCCC1 |
| InChI | InChI=1S/C17H26BrNO/c18-17-8-12-5-13(9-17)7-16(6-12,11-17)10-15(20)19-14-3-1-2-4-14/h12-14H,1-11H2,(H,19,20)/t12-,13-,16?,17?/m1/s1 |
| InChIKey | ZPBBYWARRDVCMA-QJRTVWDNSA-N |
| XLogP | 4.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|