C18H25BrN2O4 — CID 9319608
[2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate (PubChem CID 9319608) has the molecular formula C18H25BrN2O4 and a molecular weight of 413.31 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
|---|---|
| PubChem CID | 9319608 |
| Molecular Formula | C18H25BrN2O4 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
| SMILES | O=C(COC(=O)CC12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)NC(=O)NC1CC1 |
| InChI | InChI=1S/C18H25BrN2O4/c19-18-6-11-3-12(7-18)5-17(4-11,10-18)8-15(23)25-9-14(22)21-16(24)20-13-1-2-13/h11-13H,1-10H2,(H2,20,21,22,24)/t11-,12+,17?,18? |
| InChIKey | HJCVWQPGIZXTEW-CCHVVGMOSA-N |
| XLogP | 2.64 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|