C21H29BrN2O3 — CID 98309446
[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-[(5R,7R)-3-bromo-1-adamantyl]acetate (PubChem CID 98309446) has the molecular formula C21H29BrN2O3 and a molecular weight of 437.38 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-[(5R,7R)-3-bromo-1-adamantyl]acetate.
| Compound Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-[(5R,7R)-3-bromo-1-adamantyl]acetate |
|---|---|
| PubChem CID | 98309446 |
| Molecular Formula | C21H29BrN2O3 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-[(5R,7R)-3-bromo-1-adamantyl]acetate |
| SMILES | N#CC1(NC(=O)COC(=O)CC23C[C@H]4C[C@@H](CC(Br)(C4)C2)C3)CCCCC1 |
| InChI | InChI=1S/C21H29BrN2O3/c22-20-9-15-6-16(10-20)8-19(7-15,13-20)11-18(26)27-12-17(25)24-21(14-23)4-2-1-3-5-21/h15-16H,1-13H2,(H,24,25)/t15-,16-,19?,20?/m1/s1 |
| InChIKey | XKSPTTHMAWMYGQ-JZFKGDSASA-N |
| XLogP | 4.00 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|