C21H32BrNO3 — CID 7846853
[2-(cycloheptylamino)-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate (PubChem CID 7846853) has the molecular formula C21H32BrNO3 and a molecular weight of 426.40 g/mol. Its IUPAC name is [2-(cycloheptylamino)-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate.
| Compound Name | [2-(cycloheptylamino)-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
|---|---|
| PubChem CID | 7846853 |
| Molecular Formula | C21H32BrNO3 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [2-(cycloheptylamino)-2-oxoethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
| SMILES | O=C(COC(=O)CC12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)NC1CCCCCC1 |
| InChI | InChI=1S/C21H32BrNO3/c22-21-10-15-7-16(11-21)9-20(8-15,14-21)12-19(25)26-13-18(24)23-17-5-3-1-2-4-6-17/h15-17H,1-14H2,(H,23,24)/t15-,16+,20?,21? |
| InChIKey | BFQVAKKNUIWFSE-XBLGPDGASA-N |
| XLogP | 4.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|