C19H28BrNO4 — CID 23327099
[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-[(5S,7S)-3-bromo-1-adamantyl]acetate (PubChem CID 23327099) has the molecular formula C19H28BrNO4 and a molecular weight of 414.34 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-[(5S,7S)-3-bromo-1-adamantyl]acetate.
| Compound Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-[(5S,7S)-3-bromo-1-adamantyl]acetate |
|---|---|
| PubChem CID | 23327099 |
| Molecular Formula | C19H28BrNO4 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 2-[(5S,7S)-3-bromo-1-adamantyl]acetate |
| SMILES | O=C(COC(=O)CC12C[C@@H]3C[C@H](CC(Br)(C3)C1)C2)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H28BrNO4/c20-19-7-13-4-14(8-19)6-18(5-13,12-19)9-17(23)25-11-16(22)21-10-15-2-1-3-24-15/h13-15H,1-12H2,(H,21,22)/t13-,14-,15-,18?,19?/m0/s1 |
| InChIKey | ACKAWLATECFGBH-CKMLOSLVSA-N |
| XLogP | 2.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|