C16H26N2O5 — CID 51609217
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(cyclohexanecarbonylamino)acetate (PubChem CID 51609217) has the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(cyclohexanecarbonylamino)acetate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(cyclohexanecarbonylamino)acetate |
|---|---|
| PubChem CID | 51609217 |
| Molecular Formula | C16H26N2O5 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-(cyclohexanecarbonylamino)acetate |
| SMILES | O=C(COC(=O)CNC(=O)C1CCCCC1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C16H26N2O5/c19-14(17-9-13-7-4-8-22-13)11-23-15(20)10-18-16(21)12-5-2-1-3-6-12/h12-13H,1-11H2,(H,17,19)(H,18,21)/t13-/m1/s1 |
| InChIKey | NRXZBYXNUKEDGU-CYBMUJFWSA-N |
| XLogP | 0.52 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |