C19H32N2O3 — CID 109146083
4-N-cyclohexyl-1-N-(oxolan-2-ylmethyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109146083) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is 4-N-cyclohexyl-1-N-(oxolan-2-ylmethyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-cyclohexyl-1-N-(oxolan-2-ylmethyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109146083 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | 4-N-cyclohexyl-1-N-(oxolan-2-ylmethyl)cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(NCC1CCCO1)C1CCC(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C19H32N2O3/c22-18(20-13-17-7-4-12-24-17)14-8-10-15(11-9-14)19(23)21-16-5-2-1-3-6-16/h14-17H,1-13H2,(H,20,22)(H,21,23) |
| InChIKey | DXAXFDRAQRKVPM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |