C18H33ClN2O2 — CID 163326678
1-(cyclohexylmethyl)-N-(oxolan-2-ylmethyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 163326678) has the molecular formula C18H33ClN2O2 and a molecular weight of 344.93 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-N-(oxolan-2-ylmethyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | 1-(cyclohexylmethyl)-N-(oxolan-2-ylmethyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 163326678 |
| Molecular Formula | C18H33ClN2O2 |
| Molecular Weight | 344.93 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-(cyclohexylmethyl)-N-(oxolan-2-ylmethyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC1CCCO1)C1CCN(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C18H32N2O2.ClH/c21-18(19-13-17-7-4-12-22-17)16-8-10-20(11-9-16)14-15-5-2-1-3-6-15;/h15-17H,1-14H2,(H,19,21);1H |
| InChIKey | KMTWRBZBDLTRSA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.93 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |