C17H30N2O3 — CID 109145407
4-N-butan-2-yl-1-N-(oxolan-2-ylmethyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109145407) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-N-butan-2-yl-1-N-(oxolan-2-ylmethyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-butan-2-yl-1-N-(oxolan-2-ylmethyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109145407 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 4-N-butan-2-yl-1-N-(oxolan-2-ylmethyl)cyclohexane-1,4-dicarboxamide |
| SMILES | CCC(C)NC(=O)C1CCC(C(=O)NCC2CCCO2)CC1 |
| InChI | InChI=1S/C17H30N2O3/c1-3-12(2)19-17(21)14-8-6-13(7-9-14)16(20)18-11-15-5-4-10-22-15/h12-15H,3-11H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | KYVSUHHINJRNMV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |