C21H37N3O2S — CID 30869368
N-[[(2S)-oxolan-2-yl]methyl]-1-[1-(thian-4-yl)piperidin-4-yl]piperidine-4-carboxamide (PubChem CID 30869368) has the molecular formula C21H37N3O2S and a molecular weight of 395.61 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-1-[1-(thian-4-yl)piperidin-4-yl]piperidine-4-carboxamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-1-[1-(thian-4-yl)piperidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30869368 |
| Molecular Formula | C21H37N3O2S |
| Molecular Weight | 395.61 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-1-[1-(thian-4-yl)piperidin-4-yl]piperidine-4-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)C1CCN(C2CCN(C3CCSCC3)CC2)CC1 |
| InChI | InChI=1S/C21H37N3O2S/c25-21(22-16-20-2-1-13-26-20)17-3-9-23(10-4-17)18-5-11-24(12-6-18)19-7-14-27-15-8-19/h17-20H,1-16H2,(H,22,25)/t20-/m0/s1 |
| InChIKey | BJJQNSPHTGEFTP-FQEVSTJZSA-N |
| XLogP | 2.35 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.61 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |