C18H26BrNO3 — CID 2377224
(2-oxo-2-pyrrolidin-1-ylethyl) 2-[(5S,7R)-3-bromo-1-adamantyl]acetate (PubChem CID 2377224) has the molecular formula C18H26BrNO3 and a molecular weight of 384.31 g/mol. Its IUPAC name is (2-oxo-2-pyrrolidin-1-ylethyl) 2-[(5S,7R)-3-bromo-1-adamantyl]acetate.
| Compound Name | (2-oxo-2-pyrrolidin-1-ylethyl) 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
|---|---|
| PubChem CID | 2377224 |
| Molecular Formula | C18H26BrNO3 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (2-oxo-2-pyrrolidin-1-ylethyl) 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
| SMILES | O=C(CC12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)OCC(=O)N1CCCC1 |
| InChI | InChI=1S/C18H26BrNO3/c19-18-8-13-5-14(9-18)7-17(6-13,12-18)10-16(22)23-11-15(21)20-3-1-2-4-20/h13-14H,1-12H2/t13-,14+,17?,18? |
| InChIKey | BZFCGCMVZHGTTN-MWABVPJASA-N |
| XLogP | 3.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|