C19H26BrN3O3 — CID 98325811
[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl] 2-[(5R,7R)-3-bromo-1-adamantyl]acetate (PubChem CID 98325811) has the molecular formula C19H26BrN3O3 and a molecular weight of 424.34 g/mol. Its IUPAC name is [2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl] 2-[(5R,7R)-3-bromo-1-adamantyl]acetate.
| Compound Name | [2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl] 2-[(5R,7R)-3-bromo-1-adamantyl]acetate |
|---|---|
| PubChem CID | 98325811 |
| Molecular Formula | C19H26BrN3O3 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | [2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl] 2-[(5R,7R)-3-bromo-1-adamantyl]acetate |
| SMILES | Cc1cc(NC(=O)COC(=O)CC23C[C@H]4C[C@@H](CC(Br)(C4)C2)C3)n(C)n1 |
| InChI | InChI=1S/C19H26BrN3O3/c1-12-3-15(23(2)22-12)21-16(24)10-26-17(25)9-18-5-13-4-14(6-18)8-19(20,7-13)11-18/h3,13-14H,4-11H2,1-2H3,(H,21,24)/t13-,14-,18?,19?/m1/s1 |
| InChIKey | GIVZUTMHEFBSOA-CXTCDGGRSA-N |
| XLogP | 3.33 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|