C20H23BrN2O3S — CID 99846728
[(3R)-3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 2-[(5R,7R)-3-bromo-1-adamantyl]acetate (PubChem CID 99846728) has the molecular formula C20H23BrN2O3S and a molecular weight of 451.39 g/mol. Its IUPAC name is [(3R)-3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 2-[(5R,7R)-3-bromo-1-adamantyl]acetate.
| Compound Name | [(3R)-3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 2-[(5R,7R)-3-bromo-1-adamantyl]acetate |
|---|---|
| PubChem CID | 99846728 |
| Molecular Formula | C20H23BrN2O3S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | [(3R)-3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 2-[(5R,7R)-3-bromo-1-adamantyl]acetate |
| SMILES | Cc1csc([C@H](C#N)C(=O)COC(=O)CC23C[C@H]4C[C@@H](CC(Br)(C4)C2)C3)n1 |
| InChI | InChI=1S/C20H23BrN2O3S/c1-12-10-27-18(23-12)15(8-22)16(24)9-26-17(25)7-19-3-13-2-14(4-19)6-20(21,5-13)11-19/h10,13-15H,2-7,9,11H2,1H3/t13-,14-,15-,19?,20?/m1/s1 |
| InChIKey | SLGAUMZBHZWHSM-IXERNEQCSA-N |
| XLogP | 4.30 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|