C21H27BrO2 — CID 7846841
(2,5-dimethylphenyl)methyl 2-[(5S,7R)-3-bromo-1-adamantyl]acetate (PubChem CID 7846841) has the molecular formula C21H27BrO2 and a molecular weight of 391.35 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl 2-[(5S,7R)-3-bromo-1-adamantyl]acetate.
| Compound Name | (2,5-dimethylphenyl)methyl 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
|---|---|
| PubChem CID | 7846841 |
| Molecular Formula | C21H27BrO2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (2,5-dimethylphenyl)methyl 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
| SMILES | Cc1ccc(C)c(COC(=O)CC23C[C@@H]4C[C@@H](CC(Br)(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H27BrO2/c1-14-3-4-15(2)18(5-14)12-24-19(23)11-20-7-16-6-17(8-20)10-21(22,9-16)13-20/h3-5,16-17H,6-13H2,1-2H3/t16-,17+,20?,21? |
| InChIKey | RTXQVMCHSYDVQH-AGXSTUJCSA-N |
| XLogP | 5.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|