C24H29BrO6 — CID 98640335
diethyl 5-[2-[(5S,7S)-3-bromo-1-adamantyl]acetyl]oxybenzene-1,3-dicarboxylate (PubChem CID 98640335) has the molecular formula C24H29BrO6 and a molecular weight of 493.39 g/mol. Its IUPAC name is diethyl 5-[2-[(5S,7S)-3-bromo-1-adamantyl]acetyl]oxybenzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[2-[(5S,7S)-3-bromo-1-adamantyl]acetyl]oxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 98640335 |
| Molecular Formula | C24H29BrO6 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | diethyl 5-[2-[(5S,7S)-3-bromo-1-adamantyl]acetyl]oxybenzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(OC(=O)CC23C[C@@H]4C[C@H](CC(Br)(C4)C2)C3)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C24H29BrO6/c1-3-29-21(27)17-6-18(22(28)30-4-2)8-19(7-17)31-20(26)13-23-9-15-5-16(10-23)12-24(25,11-15)14-23/h6-8,15-16H,3-5,9-14H2,1-2H3/t15-,16-,23?,24?/m0/s1 |
| InChIKey | RALOPXWWFVRHLD-DQCONPEVSA-N |
| XLogP | 5.07 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|