C19H22BrClO2 — CID 7846846
(3-chlorophenyl)methyl 2-[(5S,7R)-3-bromo-1-adamantyl]acetate (PubChem CID 7846846) has the molecular formula C19H22BrClO2 and a molecular weight of 397.74 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 2-[(5S,7R)-3-bromo-1-adamantyl]acetate.
| Compound Name | (3-chlorophenyl)methyl 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
|---|---|
| PubChem CID | 7846846 |
| Molecular Formula | C19H22BrClO2 |
| Molecular Weight | 397.74 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | (3-chlorophenyl)methyl 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
| SMILES | O=C(CC12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H22BrClO2/c20-19-8-14-4-15(9-19)7-18(6-14,12-19)10-17(22)23-11-13-2-1-3-16(21)5-13/h1-3,5,14-15H,4,6-12H2/t14-,15+,18?,19? |
| InChIKey | UVPNYUJLHCJYOD-MYMYQCDVSA-N |
| XLogP | 5.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.74 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|