C20H24BrClO2 — CID 7846864
[(1R)-1-(2-chlorophenyl)ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate (PubChem CID 7846864) has the molecular formula C20H24BrClO2 and a molecular weight of 411.77 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
|---|---|
| PubChem CID | 7846864 |
| Molecular Formula | C20H24BrClO2 |
| Molecular Weight | 411.77 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl] 2-[(5S,7R)-3-bromo-1-adamantyl]acetate |
| SMILES | C[C@@H](OC(=O)CC12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)c1ccccc1Cl |
| InChI | InChI=1S/C20H24BrClO2/c1-13(16-4-2-3-5-17(16)22)24-18(23)11-19-7-14-6-15(8-19)10-20(21,9-14)12-19/h2-5,13-15H,6-12H2,1H3/t13-,14-,15+,19?,20?/m1/s1 |
| InChIKey | ZFKMDDIOLQHHNP-RQBCQMOYSA-N |
| XLogP | 6.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.77 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|