C21H26BrF2NO2 — CID 98685276
2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(1R)-1-[2-(difluoromethoxy)phenyl]ethyl]acetamide (PubChem CID 98685276) has the molecular formula C21H26BrF2NO2 and a molecular weight of 442.34 g/mol. Its IUPAC name is 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(1R)-1-[2-(difluoromethoxy)phenyl]ethyl]acetamide.
| Compound Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(1R)-1-[2-(difluoromethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 98685276 |
| Molecular Formula | C21H26BrF2NO2 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(1R)-1-[2-(difluoromethoxy)phenyl]ethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CC12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2)c1ccccc1OC(F)F |
| InChI | InChI=1S/C21H26BrF2NO2/c1-13(16-4-2-3-5-17(16)27-19(23)24)25-18(26)11-20-7-14-6-15(8-20)10-21(22,9-14)12-20/h2-5,13-15,19H,6-12H2,1H3,(H,25,26)/t13-,14-,15-,20?,21?/m1/s1 |
| InChIKey | TVIJPVRUFJECCF-WSACYYNKSA-N |
| XLogP | 5.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|