C19H22BrF2NO2 — CID 4005768
2-(3-bromo-1-adamantyl)-N-[2-(difluoromethoxy)phenyl]acetamide (PubChem CID 4005768) has the molecular formula C19H22BrF2NO2 and a molecular weight of 414.29 g/mol. Its IUPAC name is 2-(3-bromo-1-adamantyl)-N-[2-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-(3-bromo-1-adamantyl)-N-[2-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 4005768 |
| Molecular Formula | C19H22BrF2NO2 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 2-(3-bromo-1-adamantyl)-N-[2-(difluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(Br)(C3)C1)C2)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C19H22BrF2NO2/c20-19-8-12-5-13(9-19)7-18(6-12,11-19)10-16(24)23-14-3-1-2-4-15(14)25-17(21)22/h1-4,12-13,17H,5-11H2,(H,23,24) |
| InChIKey | QKMMGRCAQUJITQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|