C20H25BrClNO3 — CID 98341333
2-[(5R,7R)-3-bromo-1-adamantyl]-N-(2-chloro-4,5-dimethoxyphenyl)acetamide (PubChem CID 98341333) has the molecular formula C20H25BrClNO3 and a molecular weight of 442.78 g/mol. Its IUPAC name is 2-[(5R,7R)-3-bromo-1-adamantyl]-N-(2-chloro-4,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-N-(2-chloro-4,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98341333 |
| Molecular Formula | C20H25BrClNO3 |
| Molecular Weight | 442.78 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-N-(2-chloro-4,5-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(Cl)c(NC(=O)CC23C[C@H]4C[C@@H](CC(Br)(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C20H25BrClNO3/c1-25-16-4-14(22)15(5-17(16)26-2)23-18(24)10-19-6-12-3-13(7-19)9-20(21,8-12)11-19/h4-5,12-13H,3,6-11H2,1-2H3,(H,23,24)/t12-,13-,19?,20?/m1/s1 |
| InChIKey | MAERJVOHQDQDFS-CJKMCJCZSA-N |
| XLogP | 5.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.78 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|