C21H28BrNO3 — CID 46541541
2-(3-bromo-1-adamantyl)-N-[(2,5-dimethoxyphenyl)methyl]acetamide (PubChem CID 46541541) has the molecular formula C21H28BrNO3 and a molecular weight of 422.36 g/mol. Its IUPAC name is 2-(3-bromo-1-adamantyl)-N-[(2,5-dimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(3-bromo-1-adamantyl)-N-[(2,5-dimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 46541541 |
| Molecular Formula | C21H28BrNO3 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-(3-bromo-1-adamantyl)-N-[(2,5-dimethoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(OC)c(CNC(=O)CC23CC4CC(CC(Br)(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H28BrNO3/c1-25-17-3-4-18(26-2)16(6-17)12-23-19(24)11-20-7-14-5-15(8-20)10-21(22,9-14)13-20/h3-4,6,14-15H,5,7-13H2,1-2H3,(H,23,24) |
| InChIKey | ZJPYVMWUZFFVJU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|