C19H27BrN2OS — CID 99973609
2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]acetamide (PubChem CID 99973609) has the molecular formula C19H27BrN2OS and a molecular weight of 411.41 g/mol. Its IUPAC name is 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]acetamide.
| Compound Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 99973609 |
| Molecular Formula | C19H27BrN2OS |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2-[(5R,7R)-3-bromo-1-adamantyl]-N-[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]acetamide |
| SMILES | CCc1nc([C@H](C)NC(=O)CC23C[C@H]4C[C@@H](CC(Br)(C4)C2)C3)cs1 |
| InChI | InChI=1S/C19H27BrN2OS/c1-3-17-22-15(10-24-17)12(2)21-16(23)9-18-5-13-4-14(6-18)8-19(20,7-13)11-18/h10,12-14H,3-9,11H2,1-2H3,(H,21,23)/t12-,13+,14+,18?,19?/m0/s1 |
| InChIKey | UAOQTSMYRSOFJL-LUIVIUGWSA-N |
| XLogP | 5.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|