C22H31NO — CID 7303372
2-(1-adamantyl)-N-[(1R)-1-(4-ethylphenyl)ethyl]acetamide (PubChem CID 7303372) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[(1R)-1-(4-ethylphenyl)ethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[(1R)-1-(4-ethylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 7303372 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 2-(1-adamantyl)-N-[(1R)-1-(4-ethylphenyl)ethyl]acetamide |
| SMILES | CCc1ccc([C@@H](C)NC(=O)CC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H31NO/c1-3-16-4-6-20(7-5-16)15(2)23-21(24)14-22-11-17-8-18(12-22)10-19(9-17)13-22/h4-7,15,17-19H,3,8-14H2,1-2H3,(H,23,24)/t15-,17?,18?,19?,22?/m1/s1 |
| InChIKey | BZTTTXHMKNUCTK-VZLUNSFSSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |