C24H35N3O4S — CID 55948108
2-(1-adamantyl)-N-[2-[1-[4-(dimethylsulfamoyl)phenyl]ethylamino]-2-oxoethyl]acetamide (PubChem CID 55948108) has the molecular formula C24H35N3O4S and a molecular weight of 461.63 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-[1-[4-(dimethylsulfamoyl)phenyl]ethylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-[1-[4-(dimethylsulfamoyl)phenyl]ethylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 55948108 |
| Molecular Formula | C24H35N3O4S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-[1-[4-(dimethylsulfamoyl)phenyl]ethylamino]-2-oxoethyl]acetamide |
| SMILES | CC(NC(=O)CNC(=O)CC12CC3CC(CC(C3)C1)C2)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C24H35N3O4S/c1-16(20-4-6-21(7-5-20)32(30,31)27(2)3)26-23(29)15-25-22(28)14-24-11-17-8-18(12-24)10-19(9-17)13-24/h4-7,16-19H,8-15H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | UBVFKQQSWAKHEX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |