C23H30BrNO3S — CID 98121156
ethyl 2-[[2-[(5R,7R)-3-bromo-1-adamantyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 98121156) has the molecular formula C23H30BrNO3S and a molecular weight of 480.47 g/mol. Its IUPAC name is ethyl 2-[[2-[(5R,7R)-3-bromo-1-adamantyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(5R,7R)-3-bromo-1-adamantyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 98121156 |
| Molecular Formula | C23H30BrNO3S |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | ethyl 2-[[2-[(5R,7R)-3-bromo-1-adamantyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CC23C[C@H]4C[C@@H](CC(Br)(C4)C2)C3)sc2c1CCCC2 |
| InChI | InChI=1S/C23H30BrNO3S/c1-2-28-21(27)19-16-5-3-4-6-17(16)29-20(19)25-18(26)12-22-8-14-7-15(9-22)11-23(24,10-14)13-22/h14-15H,2-13H2,1H3,(H,25,26)/t14-,15-,22?,23?/m1/s1 |
| InChIKey | ANZSUUBQMCNMDL-KKQCZIFWSA-N |
| XLogP | 5.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|