C23H31NO3S — CID 68905944
ethyl 2-(tricyclo[3.3.1.03,7]nonane-3-carbonylamino)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 68905944) has the molecular formula C23H31NO3S and a molecular weight of 401.57 g/mol. Its IUPAC name is ethyl 2-(tricyclo[3.3.1.03,7]nonane-3-carbonylamino)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-(tricyclo[3.3.1.03,7]nonane-3-carbonylamino)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 68905944 |
| Molecular Formula | C23H31NO3S |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | ethyl 2-(tricyclo[3.3.1.03,7]nonane-3-carbonylamino)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C23CC4CC(CC2C4)C3)sc2c1CCCCCC2 |
| InChI | InChI=1S/C23H31NO3S/c1-2-27-21(25)19-17-7-5-3-4-6-8-18(17)28-20(19)24-22(26)23-12-14-9-15(13-23)11-16(23)10-14/h14-16H,2-13H2,1H3,(H,24,26) |
| InChIKey | HLXXSICTJKPEDX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |