C21H27BrN2O2S — CID 4831139
2-[[2-(3-bromo-1-adamantyl)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 4831139) has the molecular formula C21H27BrN2O2S and a molecular weight of 451.43 g/mol. Its IUPAC name is 2-[[2-(3-bromo-1-adamantyl)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-(3-bromo-1-adamantyl)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 4831139 |
| Molecular Formula | C21H27BrN2O2S |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 2-[[2-(3-bromo-1-adamantyl)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)CC23CC4CC(CC(Br)(C4)C2)C3)sc2c1CCCC2 |
| InChI | InChI=1S/C21H27BrN2O2S/c22-21-8-12-5-13(9-21)7-20(6-12,11-21)10-16(25)24-19-17(18(23)26)14-3-1-2-4-15(14)27-19/h12-13H,1-11H2,(H2,23,26)(H,24,25) |
| InChIKey | HNQZZHGDCAOFBT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|