C24H25BrO4 — CID 98298408
(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-[(5R,7R)-3-bromo-1-adamantyl]acetate (PubChem CID 98298408) has the molecular formula C24H25BrO4 and a molecular weight of 457.36 g/mol. Its IUPAC name is (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-[(5R,7R)-3-bromo-1-adamantyl]acetate.
| Compound Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-[(5R,7R)-3-bromo-1-adamantyl]acetate |
|---|---|
| PubChem CID | 98298408 |
| Molecular Formula | C24H25BrO4 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 2-[(5R,7R)-3-bromo-1-adamantyl]acetate |
| SMILES | O=C(CC12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2)Oc1ccc2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C24H25BrO4/c25-24-10-14-6-15(11-24)9-23(8-14,13-24)12-21(26)28-16-4-5-18-17-2-1-3-19(17)22(27)29-20(18)7-16/h4-5,7,14-15H,1-3,6,8-13H2/t14-,15-,23?,24?/m1/s1 |
| InChIKey | RWJOCMJGGZYWSH-FCZYIYOXSA-N |
| XLogP | 5.31 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|