C25H29NO4 — CID 7921272
N-(1-adamantylmethyl)-2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetamide (PubChem CID 7921272) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetamide.
| Compound Name | N-(1-adamantylmethyl)-2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetamide |
|---|---|
| PubChem CID | 7921272 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N-(1-adamantylmethyl)-2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetamide |
| SMILES | O=C(COc1ccc2c3c(c(=O)oc2c1)CCC3)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H29NO4/c27-23(26-14-25-10-15-6-16(11-25)8-17(7-15)12-25)13-29-18-4-5-20-19-2-1-3-21(19)24(28)30-22(20)9-18/h4-5,9,15-17H,1-3,6-8,10-14H2,(H,26,27) |
| InChIKey | AZPYEKWUVKZQPJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|