C20H26ClNO2 — CID 7921336
N-(1-adamantylmethyl)-2-(4-chloro-3-methylphenoxy)acetamide (PubChem CID 7921336) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-(4-chloro-3-methylphenoxy)acetamide.
| Compound Name | N-(1-adamantylmethyl)-2-(4-chloro-3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 7921336 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-(1-adamantylmethyl)-2-(4-chloro-3-methylphenoxy)acetamide |
| SMILES | Cc1cc(OCC(=O)NCC23CC4CC(CC(C4)C2)C3)ccc1Cl |
| InChI | InChI=1S/C20H26ClNO2/c1-13-4-17(2-3-18(13)21)24-11-19(23)22-12-20-8-14-5-15(9-20)7-16(6-14)10-20/h2-4,14-16H,5-12H2,1H3,(H,22,23) |
| InChIKey | OWTAKZUWFMDMHQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |