C15H22N2O3 — CID 18206853
[2-[(1-cyanocycloheptyl)amino]-2-oxoethyl] (E)-pent-2-enoate (PubChem CID 18206853) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is [2-[(1-cyanocycloheptyl)amino]-2-oxoethyl] (E)-pent-2-enoate.
| Compound Name | [2-[(1-cyanocycloheptyl)amino]-2-oxoethyl] (E)-pent-2-enoate |
|---|---|
| PubChem CID | 18206853 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | [2-[(1-cyanocycloheptyl)amino]-2-oxoethyl] (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)OCC(=O)NC1(C#N)CCCCCC1 |
| InChI | InChI=1S/C15H22N2O3/c1-2-3-8-14(19)20-11-13(18)17-15(12-16)9-6-4-5-7-10-15/h3,8H,2,4-7,9-11H2,1H3,(H,17,18)/b8-3+ |
| InChIKey | YSYRBZNLXMFRAV-FPYGCLRLSA-N |
| XLogP | 2.23 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|