C14H20N2O3 — CID 7717691
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] cyclopentanecarboxylate (PubChem CID 7717691) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] cyclopentanecarboxylate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 7717691 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] cyclopentanecarboxylate |
| SMILES | N#CC1(NC(=O)COC(=O)C2CCCC2)CCCC1 |
| InChI | InChI=1S/C14H20N2O3/c15-10-14(7-3-4-8-14)16-12(17)9-19-13(18)11-5-1-2-6-11/h11H,1-9H2,(H,16,17) |
| InChIKey | UGKXULRNQKDICH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |