C15H24N3O3+ — CID 8741890
methyl 1-[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate (PubChem CID 8741890) has the molecular formula C15H24N3O3+ and a molecular weight of 294.38 g/mol. Its IUPAC name is methyl 1-[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | methyl 1-[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8741890 |
| Molecular Formula | C15H24N3O3+ |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | methyl 1-[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
| SMILES | COC(=O)C1CC[NH+](CC(=O)NC2(C#N)CCCC2)CC1 |
| InChI | InChI=1S/C15H23N3O3/c1-21-14(20)12-4-8-18(9-5-12)10-13(19)17-15(11-16)6-2-3-7-15/h12H,2-10H2,1H3,(H,17,19)/p+1 |
| InChIKey | HBXQJYUTXFQVDA-UHFFFAOYSA-O |
| XLogP | -0.59 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |