C15H25N4O3+ — CID 8931965
ethyl 4-[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]piperazin-4-ium-1-carboxylate (PubChem CID 8931965) has the molecular formula C15H25N4O3+ and a molecular weight of 309.39 g/mol. Its IUPAC name is ethyl 4-[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]piperazin-4-ium-1-carboxylate.
| Compound Name | ethyl 4-[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 8931965 |
| Molecular Formula | C15H25N4O3+ |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | ethyl 4-[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl]piperazin-4-ium-1-carboxylate |
| SMILES | CCOC(=O)N1CC[NH+](CC(=O)NC2(C#N)CCCC2)CC1 |
| InChI | InChI=1S/C15H24N4O3/c1-2-22-14(21)19-9-7-18(8-10-19)11-13(20)17-15(12-16)5-3-4-6-15/h2-11H2,1H3,(H,17,20)/p+1 |
| InChIKey | HRESINXNPMGLGM-UHFFFAOYSA-O |
| XLogP | -0.70 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |