C12H19N2O3+ — CID 8754658
methyl 1-[2-oxo-2-(prop-2-ynylamino)ethyl]piperidin-1-ium-4-carboxylate (PubChem CID 8754658) has the molecular formula C12H19N2O3+ and a molecular weight of 239.29 g/mol. Its IUPAC name is methyl 1-[2-oxo-2-(prop-2-ynylamino)ethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | methyl 1-[2-oxo-2-(prop-2-ynylamino)ethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8754658 |
| Molecular Formula | C12H19N2O3+ |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | methyl 1-[2-oxo-2-(prop-2-ynylamino)ethyl]piperidin-1-ium-4-carboxylate |
| SMILES | C#CCNC(=O)C[NH+]1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C12H18N2O3/c1-3-6-13-11(15)9-14-7-4-10(5-8-14)12(16)17-2/h1,10H,4-9H2,2H3,(H,13,15)/p+1 |
| InChIKey | DPLIWDIUWBEXCX-UHFFFAOYSA-O |
| XLogP | -1.80 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|