C19H29N2O3+ — CID 8754516
methyl 1-[2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate (PubChem CID 8754516) has the molecular formula C19H29N2O3+ and a molecular weight of 333.45 g/mol. Its IUPAC name is methyl 1-[2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | methyl 1-[2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8754516 |
| Molecular Formula | C19H29N2O3+ |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | methyl 1-[2-[[(1R)-1-(4-ethylphenyl)ethyl]amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCc1ccc([C@@H](C)NC(=O)C[NH+]2CCC(C(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C19H28N2O3/c1-4-15-5-7-16(8-6-15)14(2)20-18(22)13-21-11-9-17(10-12-21)19(23)24-3/h5-8,14,17H,4,9-13H2,1-3H3,(H,20,22)/p+1/t14-/m1/s1 |
| InChIKey | BXTFSPUTSVGTBS-CQSZACIVSA-O |
| XLogP | 0.89 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |