C20H32N3O2+ — CID 9276356
2-(4-acetylpiperazin-1-ium-1-yl)-N-[(1S)-1-(4-ethylphenyl)-2-methylpropyl]acetamide (PubChem CID 9276356) has the molecular formula C20H32N3O2+ and a molecular weight of 346.50 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-ium-1-yl)-N-[(1S)-1-(4-ethylphenyl)-2-methylpropyl]acetamide.
| Compound Name | 2-(4-acetylpiperazin-1-ium-1-yl)-N-[(1S)-1-(4-ethylphenyl)-2-methylpropyl]acetamide |
|---|---|
| PubChem CID | 9276356 |
| Molecular Formula | C20H32N3O2+ |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 2-(4-acetylpiperazin-1-ium-1-yl)-N-[(1S)-1-(4-ethylphenyl)-2-methylpropyl]acetamide |
| SMILES | CCc1ccc([C@@H](NC(=O)C[NH+]2CCN(C(C)=O)CC2)C(C)C)cc1 |
| InChI | InChI=1S/C20H31N3O2/c1-5-17-6-8-18(9-7-17)20(15(2)3)21-19(25)14-22-10-12-23(13-11-22)16(4)24/h6-9,15,20H,5,10-14H2,1-4H3,(H,21,25)/p+1/t20-/m0/s1 |
| InChIKey | UWGCALWQTNXLKZ-FQEVSTJZSA-O |
| XLogP | 0.81 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |